cas: 4442-53-9 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[1,4]dioxine-5-carboxylic acid, 98% (CAS 4442-53-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015591-1G |
| cas | 4442-53-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 284.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 4442-53-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: VCLSWKVAHAJSFL-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | VCLSWKVAHAJSFL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)