cas: 250674-49-8 — see every product listed under this CAS number, including other names
1,7-Naphthyridine-3-carboxylic acid 97% (CAS 250674-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A627102-100mg |
| cas | 250674-49-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 1193.62 Pln | |
| Ambeed | 1g | 3485.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A627102 |
1,7-naphthyridine-3-carboxylic acid (CAS 250674-49-8) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-3-carboxylic acid. InChIKey: HJYYQFVLSQWEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,7-naphthyridine-3-carboxylic acid |
| InChIKey | HJYYQFVLSQWEDJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=NC=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)