cas: 250674-49-8 — see every product listed under this CAS number, including other names
1,7-Naphthyridine-3-carboxylic acid, 98%, 98% (CAS 250674-49-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QCU-25mg |
| cas | 250674-49-8 |
| size | 25mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 266.00 Pln | |
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 1950.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,7-naphthyridine-3-carboxylic acid (CAS 250674-49-8) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-3-carboxylic acid. InChIKey: HJYYQFVLSQWEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,7-naphthyridine-3-carboxylic acid |
| InChIKey | HJYYQFVLSQWEDJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=NC=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)