cas: 21222-61-7 — see every product listed under this CAS number, including other names
1-(2-Aminobenzo[d]thiazol-6-yl)ethan-1-one, 97% (CAS 21222-61-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F611830-1G |
| cas | 21222-61-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1346.42 Pln | |
| Fluorochem | 50g | 2382.51 Pln | |
| Fluorochem | 100g | 4267.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(2-amino-1,3-benzothiazol-6-yl)ethanone (CAS 21222-61-7) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 1-(2-amino-1,3-benzothiazol-6-yl)ethanone. InChIKey: OKAQYTQTHTXQQH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 1-(2-amino-1,3-benzothiazol-6-yl)ethanone |
| InChIKey | OKAQYTQTHTXQQH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)