cas: 21222-61-7 — see every product listed under this CAS number, including other names
1-(2-Aminobenzo[d]thiazol-6-yl)ethanone, 97%, 97% (CAS 21222-61-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117YKG-1g |
| cas | 21222-61-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 827.60 Pln | |
| Chemat | 50g | 1456.40 Pln | |
| Chemat | 100g | 2594.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2-amino-1,3-benzothiazol-6-yl)ethanone (CAS 21222-61-7) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 1-(2-amino-1,3-benzothiazol-6-yl)ethanone. InChIKey: OKAQYTQTHTXQQH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 1-(2-amino-1,3-benzothiazol-6-yl)ethanone |
| InChIKey | OKAQYTQTHTXQQH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)