cas: 1508437-73-7 — see every product listed under this CAS number, including other names
1-(2-Bromo-4-chloro-phenyl)-2,2,2-trifluoro-ethanol, 97% (CAS 1508437-73-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A838585-10g |
| cas | 1508437-73-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 44416.12 Pln | |
| AmBeed | 5g | 26643.82 Pln | |
| Fluorochem | 100mg | 1408.90 Pln | |
| Fluorochem | 250mg | 2205.49 Pln | |
| Fluorochem | 500mg | 3621.66 Pln | |
| Fluorochem | 1g | 5402.28 Pln | |
| Fluorochem | 5g | 16684.77 Pln | |
| Fluorochem | 10g | 27805.85 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1508437-73-7) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: KNGKJEAJYVSAIV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | KNGKJEAJYVSAIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)