cas: 1508437-73-7 — see every product listed under this CAS number, including other names
1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethan-1-ol, 97%, 97% (CAS 1508437-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUTA-100mg |
| cas | 1508437-73-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1350.80 Pln | |
| Chemat | 500mg | 2200.40 Pln | |
| Chemat | 1g | 3275.60 Pln | |
| Chemat | 5g | 10086.80 Pln | |
| Chemat | 10g | 16802.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1508437-73-7) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: KNGKJEAJYVSAIV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | KNGKJEAJYVSAIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)