cas: 31963-35-6 — see every product listed under this CAS number, including other names
1-(2-Phenoxyphenyl)methanamine hydrochloride 95% (CAS 31963-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104360-100mg |
| cas | 31963-35-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104360 |
(2-phenoxyphenyl)methanamine;hydrochloride (CAS 31963-35-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (2-phenoxyphenyl)methanamine;hydrochloride. InChIKey: USRYZTSPSJXQFU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | USRYZTSPSJXQFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2CN.Cl |
Computed by PubChem (NCBI)