cas: 258346-69-9 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98%, 98% (CAS 258346-69-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2C5-250mg |
| cas | 258346-69-9 |
| size | 250mg |
| availability | 9.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1792.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[4-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 258346-69-9) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: DLIOGFQTFUVFFB-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | DLIOGFQTFUVFFB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)