1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98%
cas: 258346-69-9 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98% (CAS 258346-69-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A362155-250mg |
| cas | 258346-69-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2467.44 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1792.40 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1023.62 Pln | |
| Fluorochem | 5g | 3309.27 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2652.42 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-[4-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 258346-69-9) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: DLIOGFQTFUVFFB-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | DLIOGFQTFUVFFB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1-(4-(trifluoromethyl)phenyl)butane-1,3-dione, 1-(4-Trifluoromethylphenyl)butane-1,3-dione, 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione, 1-[4-(Trifluoromethyl)phenyl]-1,3-butanedione, 1,3-Butanedione,1-[4-(trifluoromethyl)phenyl]-, 1,3-Butanedione, 1-[4-(trifluoromethyl)phenyl]-, 1-(4-trifluoromethylphenyl)-1,3-butanedione, 1-(4-trifluoromethyl-phenyl)-butane-1,3-dione