cas: 258346-69-9 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98% (CAS 258346-69-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546205-250MG |
| cas | 258346-69-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 2939.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 258346-69-9) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: DLIOGFQTFUVFFB-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | DLIOGFQTFUVFFB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)