cas: 80789-69-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclopentanecarboxylic acid 95% (CAS 80789-69-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A455746-5g |
| cas | 80789-69-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1710.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A455746 |
1-(4-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 80789-69-1) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: QJNFJEMGWIQMJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)