cas: 870063-18-6 — see every product listed under this CAS number, including other names
1-Bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene, 96%, 96% (CAS 870063-18-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NV2J-100mg |
| cas | 870063-18-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 2147.60 Pln | |
| Chemat | 5g | 4274.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene (CAS 870063-18-6) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: BEJOCBPQBFEUNB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | BEJOCBPQBFEUNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)