cas: 870063-18-6 — see every product listed under this CAS number, including other names
1-Bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene, 96% (CAS 870063-18-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1161044-5g |
| cas | 870063-18-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8441.86 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2632.42 Pln | |
| Fluorochem | 5g | 5261.71 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene (CAS 870063-18-6) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: BEJOCBPQBFEUNB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | BEJOCBPQBFEUNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)