10-Methyl-10H-phenothiazine-3,7-dicarbaldehyde, 98%
cas: 31123-52-1 — see every product listed under this CAS number, including other names
10-Methyl-10H-phenothiazine-3,7-dicarbaldehyde, 98% (CAS 31123-52-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1195886-250mg |
| cas | 31123-52-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2550.88 Pln | |
| Ambeed | 1g | 6583.69 Pln | |
| Chemat | 50mg | 683.60 Pln | |
| Chemat | 100mg | 1120.40 Pln | |
| Chemat | 250mg | 1859.60 Pln | |
| Chemat | 1g | 5133.20 Pln | |
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2611.60 Pln | |
| Fluorochem | 1g | 6599.78 Pln | |
| BLDpharm | 50mg | 869.72 Pln | |
| BLDpharm | 100mg | 1591.69 Pln | |
| BLDpharm | 250mg | 2746.84 Pln | |
| BLDpharm | 1g | 7095.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
10-methylphenothiazine-3,7-dicarbaldehyde (CAS 31123-52-1) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 10-methylphenothiazine-3,7-dicarbaldehyde. InChIKey: FCHUFBLISOGXHO-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 10-methylphenothiazine-3,7-dicarbaldehyde |
| InChIKey | FCHUFBLISOGXHO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)SC3=C1C=CC(=C3)C=O |
Computed by PubChem (NCBI)