CAS 129200-96-0 is the registry number for 3-phenyl-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-(benzenesulfonyl)-3-phenylprop-2-enenitrile (CAS 129200-96-0) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: (E)-2-(benzenesulfonyl)-3-phenylprop-2-enenitrile. InChIKey: DUYMQMOILXJIET-RVDMUPIBSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | (E)-2-(benzenesulfonyl)-3-phenylprop-2-enenitrile |
| InChIKey | DUYMQMOILXJIET-RVDMUPIBSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(\C#N)/S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)