1H-Indole-2,3-dicarboxylic acid 95%
cas: 103030-09-7 — see every product listed under this CAS number, including other names
1H-Indole-2,3-dicarboxylic acid 95% (CAS 103030-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A304429-100mg |
| cas | 103030-09-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 515.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A304429 |
1H-indole-2,3-dicarboxylic acid (CAS 103030-09-7) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,3-dicarboxylic acid. InChIKey: MBNROFBGTNXXMX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,3-dicarboxylic acid |
| InChIKey | MBNROFBGTNXXMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)