cas: 103030-09-7 — see every product listed under this CAS number, including other names
1H-Indole-2,3-dicarboxylic acid, 95%, 95% (CAS 103030-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11976P-100mg |
| cas | 103030-09-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 419.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1H-indole-2,3-dicarboxylic acid (CAS 103030-09-7) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,3-dicarboxylic acid. InChIKey: MBNROFBGTNXXMX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,3-dicarboxylic acid |
| InChIKey | MBNROFBGTNXXMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)