1H-Indole-2,5-dicarboxylic acid 97%
cas: 117140-77-9 — see every product listed under this CAS number, including other names
1H-Indole-2,5-dicarboxylic acid 97% (CAS 117140-77-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129261-250mg |
| cas | 117140-77-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 926.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129261 |
1H-indole-2,5-dicarboxylic acid (CAS 117140-77-9) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,5-dicarboxylic acid. InChIKey: MUABQYJAPOQWCH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,5-dicarboxylic acid |
| InChIKey | MUABQYJAPOQWCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)