1H-Indole-2-carboxylic acid, 4,6-difluoro-, 97%, 97%
cas: 247564-66-5 — see every product listed under this CAS number, including other names
1H-Indole-2-carboxylic acid, 4,6-difluoro-, 97%, 97% (CAS 247564-66-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PC9-250mg |
| cas | 247564-66-5 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 10g | 419.60 Pln | |
| Chemat | 25g | 952.40 Pln | |
| Chemat | 50g | 1749.20 Pln | |
| Chemat | 100g | 2978.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-difluoro-1H-indole-2-carboxylic acid (CAS 247564-66-5) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 4,6-difluoro-1H-indole-2-carboxylic acid. InChIKey: OCHGGXDZJGAUEU-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4,6-difluoro-1H-indole-2-carboxylic acid |
| InChIKey | OCHGGXDZJGAUEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)