cas: 247564-66-5 — see every product listed under this CAS number, including other names
4,6-Difluoroindole-2-carboxylic acid 97% (CAS 247564-66-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230931-250mg |
| cas | 247564-66-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 553.94 Pln | |
| Ambeed | 25g | 1221.44 Pln | |
| Ambeed | 100g | 3757.94 Pln | |
| Ambeed | 500g | 14821.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230931 |
4,6-difluoro-1H-indole-2-carboxylic acid (CAS 247564-66-5) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 4,6-difluoro-1H-indole-2-carboxylic acid. InChIKey: OCHGGXDZJGAUEU-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4,6-difluoro-1H-indole-2-carboxylic acid |
| InChIKey | OCHGGXDZJGAUEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)