cas: 380448-07-7 — see every product listed under this CAS number, including other names
1H-Indole-2-carboxylic acid, 5-chloro-3-formyl-, 95%, 95% (CAS 380448-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8HS-100mg |
| cas | 380448-07-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 3150.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-formyl-1H-indole-2-carboxylic acid (CAS 380448-07-7) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-chloro-3-formyl-1H-indole-2-carboxylic acid. InChIKey: RLWPMCOCDJKMEY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-chloro-3-formyl-1H-indole-2-carboxylic acid |
| InChIKey | RLWPMCOCDJKMEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(N2)C(=O)O)C=O |
Computed by PubChem (NCBI)