cas: 205871-52-9 — see every product listed under this CAS number, including other names
2'-Formyl-[1,1'-biphenyl]-3-carboxylic acid 95% (CAS 205871-52-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204929-250mg |
| cas | 205871-52-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1165.81 Pln | |
| Ambeed | 5g | 4570.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A204929 |
3-(2-formylphenyl)benzoic acid (CAS 205871-52-9) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(2-formylphenyl)benzoic acid. InChIKey: NWVOXGWJNSOFTE-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(2-formylphenyl)benzoic acid |
| InChIKey | NWVOXGWJNSOFTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)