cas: 205871-52-9 — see every product listed under this CAS number, including other names
2'-Formyl-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95% (CAS 205871-52-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AE2-50mg |
| cas | 205871-52-9 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1355.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(2-formylphenyl)benzoic acid (CAS 205871-52-9) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(2-formylphenyl)benzoic acid. InChIKey: NWVOXGWJNSOFTE-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(2-formylphenyl)benzoic acid |
| InChIKey | NWVOXGWJNSOFTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)