2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 97%
cas: 19956-76-4 — see every product listed under this CAS number, including other names
2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 97% (CAS 19956-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A991530-250mg |
| cas | 19956-76-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 809.81 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2667.69 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 869.72 Pln | |
| BLDpharm | 10g | 1469.51 Pln | |
| BLDpharm | 25g | 2869.01 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol (CAS 19956-76-4) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol. InChIKey: IOJCFCLZQBXCIQ-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol |
| InChIKey | IOJCFCLZQBXCIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C)C)C2=C(C(=C(C(=C2)C)O)C)C |
Computed by PubChem (NCBI)
Synonyms:
2,2',3,3',5,5'-Hexamethyl[1,1'-biphenyl]-4,4'-diol, 2,2',3,3',5,5'-Hexamethyl(1,1'-biphenyl)-4,4'-diol, 2,2',3,3',5,5'-hexamethyl-[1,1'-biphenyl]-4,4'-diol, 4,4'-Bi[2,3,6-trimethylphenol], 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol, [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3',5,5'-hexamethyl-, 4,4'-Dihydroxy-2,2',3,3',5,5'-hexamethylbiphenyl, 2,2',3,3',6,6'-hexamethyl-4,4'-biphenol, 4-(4-hydroxy-2,3,5-trimethyl-phenyl)-2,3,6-trimethyl-phenol, 2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 99%