cas: 19956-76-4 — see every product listed under this CAS number, including other names
2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 98%, 98% (CAS 19956-76-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113C7E-10g |
| cas | 19956-76-4 |
| size | 10g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1048.40 Pln | |
| Chemat | 25g | 2032.40 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol (CAS 19956-76-4) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol. InChIKey: IOJCFCLZQBXCIQ-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol |
| InChIKey | IOJCFCLZQBXCIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C)C)C2=C(C(=C(C(=C2)C)O)C)C |
Computed by PubChem (NCBI)