cas: 59384-57-5 — see every product listed under this CAS number, including other names
2,3-Dichloro-4-nitrophenol, 98% (CAS 59384-57-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334438-100MG |
| cas | 59384-57-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 565.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dichloro-4-nitrophenol (CAS 59384-57-5) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,3-dichloro-4-nitrophenol. InChIKey: SANZGCKGKOUHJG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,3-dichloro-4-nitrophenol |
| InChIKey | SANZGCKGKOUHJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)Cl)O |
Computed by PubChem (NCBI)