Products 39224-65-2
CAS 39224-65-2 appears in our catalog under these names: 4,5-Dichloro-2-nitrophenol, 4,5–Dichloro–2–nitrophenol, 5-Dichloro-2-nitrophenol, 4,5-Dichloro-2-nitrophenol 97%, 4,5-Dichloro-2-nitrophenol, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
4,5-dichloro-2-nitrophenol (CAS 39224-65-2) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 4,5-dichloro-2-nitrophenol. InChIKey: CEFFUJIHZMPDID-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 4,5-dichloro-2-nitrophenol |
| InChIKey | CEFFUJIHZMPDID-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)