CAS 50590-08-4 is the registry number for Anagrelide Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-4-nitrophenol (CAS 50590-08-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 3,5-dichloro-4-nitrophenol. InChIKey: GETDFRCRBVJZCK-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 3,5-dichloro-4-nitrophenol |
| InChIKey | GETDFRCRBVJZCK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)O |
Computed by PubChem (NCBI)