CAS 5847-57-4 appears in our catalog under these names: 2,5–Dichloro–4–Nitrophenol, 2,5-Dichloro-4-nitrophenol, 2,5-Dichloro-4-nitrophenol 98+%, 2,5-Dichloro-4-nitrophenol, 98%, 2,5-Dichloro-4-nitrophenol, >95% (HPLC). Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TRC. Available pack sizes: 1g, 10g, 100g, 250mg, 5g, 25g, 100mg, 10mg.
2,5-dichloro-4-nitrophenol (CAS 5847-57-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,5-dichloro-4-nitrophenol. InChIKey: BWQWBOCFVUBGEF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,5-dichloro-4-nitrophenol |
| InChIKey | BWQWBOCFVUBGEF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)