cas: 5447-47-2 — see every product listed under this CAS number, including other names
2,3-Dihydro-1H-cyclopenta(b)quinoline-9-carboxylic acid, 95+% (CAS 5447-47-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A182241-50mg |
| cas | 5447-47-2 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 642.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CAS 5447-47-2) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid. InChIKey: YHLOYZLGFGTCEB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
| InChIKey | YHLOYZLGFGTCEB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C3N=C2C1)C(=O)O |
Computed by PubChem (NCBI)