cas: 5447-47-2 — see every product listed under this CAS number, including other names
2,3-Dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid, 97% (CAS 5447-47-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014424-50MG |
| cas | 5447-47-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 409.25 Pln | |
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 778.91 Pln | |
| Fluorochem | 500mg | 1185.02 Pln | |
| Fluorochem | 1g | 1481.79 Pln | |
| Fluorochem | 5g | 5948.96 Pln | |
| Fluorochem | 10g | 9494.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CAS 5447-47-2) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid. InChIKey: YHLOYZLGFGTCEB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
| InChIKey | YHLOYZLGFGTCEB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C3N=C2C1)C(=O)O |
Computed by PubChem (NCBI)