cas: 5447-47-2 — see every product listed under this CAS number, including other names
2,3-Dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid, 95%, 95% (CAS 5447-47-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIWM-50mg |
| cas | 5447-47-2 |
| size | 50mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 261.20 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 909.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CAS 5447-47-2) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid. InChIKey: YHLOYZLGFGTCEB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
| InChIKey | YHLOYZLGFGTCEB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C3N=C2C1)C(=O)O |
Computed by PubChem (NCBI)