2,3-Dihydrobenzo[b]thiophene-6-carboxylic acid 1,1-dioxide, 95%
cas: 1542025-11-5 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b]thiophene-6-carboxylic acid 1,1-dioxide, 95% (CAS 1542025-11-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2928338-100mg |
| cas | 1542025-11-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1126.88 Pln | |
| Ambeed | 250mg | 1577.44 Pln | |
| Ambeed | 1g | 3118.25 Pln | |
| Ambeed | 5g | 12263.00 Pln | |
| BLDpharm | 50mg | 836.40 Pln | |
| BLDpharm | 100mg | 1208.49 Pln | |
| BLDpharm | 250mg | 1697.20 Pln | |
| BLDpharm | 1g | 3357.73 Pln | |
| BLDpharm | 5g | 13215.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid (CAS 1542025-11-5) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid. InChIKey: CILZEOQGTCWXCX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid |
| InChIKey | CILZEOQGTCWXCX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)