Products 1542025-11-5
CAS 1542025-11-5 is the registry number for 2,3-Dihydrobenzo[b]thiophene-6-carboxylic acid 1,1-dioxide, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid (CAS 1542025-11-5) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid. InChIKey: CILZEOQGTCWXCX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carboxylic acid |
| InChIKey | CILZEOQGTCWXCX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)