CAS 95535-40-3 appears in our catalog under these names: 4-(Vinylsulfonyl)benzoic acid, 95%, 4-(Vinylsulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 50mg.
4-ethenylsulfonylbenzoic acid (CAS 95535-40-3) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 4-ethenylsulfonylbenzoic acid. InChIKey: XVNBCTUERGUCCX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 4-ethenylsulfonylbenzoic acid |
| InChIKey | XVNBCTUERGUCCX-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)