CAS 150092-18-5 is the registry number for 4,6-Dimethoxybenzo[d][1,3]dioxole-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dimethoxy-1,3-benzodioxole-2-thione (CAS 150092-18-5) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 4,6-dimethoxy-1,3-benzodioxole-2-thione. InChIKey: RSOQOHPAHVYTFY-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 4,6-dimethoxy-1,3-benzodioxole-2-thione |
| InChIKey | RSOQOHPAHVYTFY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)OC(=S)O2 |
Computed by PubChem (NCBI)