CAS 1936499-21-6 is the registry number for 1,3-Dihydrobenzo[c]thiophene-5-carboxylic acid 2,2-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylic acid (CAS 1936499-21-6) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylic acid. InChIKey: ATOKBDYWJHLZSZ-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylic acid |
| InChIKey | ATOKBDYWJHLZSZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)