Products 135-13-7
CAS 135-13-7 appears in our catalog under these names: 2-(Carboxymethylthio)benzoic acid, 95%, 2-((Carboxymethyl)thio)benzoic acid, 95%, 2-((Carboxymethyl)thio)benzoic acid, 2-(CARBOXYMETHYLTHIO)BENZOIC ACID, ≥96%, ≥96%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 1000mg, 500mg, 2000mg.
2-(carboxymethylsulfanyl)benzoic acid (CAS 135-13-7) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 2-(carboxymethylsulfanyl)benzoic acid. InChIKey: GMBZSYUPMWCDGK-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2-(carboxymethylsulfanyl)benzoic acid |
| InChIKey | GMBZSYUPMWCDGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[(carboxymethyl)thio]benzoic acid, 2-((Carboxymethyl)thio)benzoic acid, 2-[(carboxymethyl)sulfanyl]benzoic acid, (o-Carboxyphenylthio)acetic acid, 2-Carboxyphenylthioglycolic acid, Acetic acid,(2-carboxyphenyl)thio-, o-((Carboxymethyl)thio)benzoic acid, o-Carboxyphenylthioglycollic acid, (2-Carboxymethylthio)benzoic acid, (o-Carboxyphenylmercapto)acetic acid