CAS 226259-48-9 is the registry number for 2,​3-​Dihydro-benzo(b)​thiophene-​5-​carboxylic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carboxylic acid (CAS 226259-48-9) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carboxylic acid. InChIKey: MPRPXLMHIKCBAC-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carboxylic acid |
| InChIKey | MPRPXLMHIKCBAC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)