Products 711-29-5
CAS 711-29-5 appears in our catalog under these names: (E)-3-(Phenylsulfonyl)acrylic Acid, 95%, 95%, (E)-3-(Phenylsulfonyl)acrylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(benzenesulfonyl)prop-2-enoic acid (CAS 711-29-5) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: (E)-3-(benzenesulfonyl)prop-2-enoic acid. InChIKey: BJFWNTBQQWFCIK-VOTSOKGWSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | (E)-3-(benzenesulfonyl)prop-2-enoic acid |
| InChIKey | BJFWNTBQQWFCIK-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)