CAS 1895985-99-5 appears in our catalog under these names: 2,3-Dihydrobenzo(b)thiophene-2-carboxylic acid 1,1-dioxide, 95%, 2,​3-Ddihydro-​benzo(b)​thiophene-​2-​carboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,1-dioxo-2,3-dihydro-1-benzothiophene-2-carboxylic acid (CAS 1895985-99-5) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-2-carboxylic acid. InChIKey: FANLYUKHUKKYMU-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-2-carboxylic acid |
| InChIKey | FANLYUKHUKKYMU-UHFFFAOYSA-N |
| SMILES | C1C(S(=O)(=O)C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)