CAS 1374667-26-1 is the registry number for 6-Hydroxythiochroman-4-one 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 1374667-26-1) is a chemical compound with the molecular formula C9H8O4S and a molecular weight of 212.22 g/mol. IUPAC name: 6-hydroxy-1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: UYOMLPSIYJPWLX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 6-hydroxy-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | UYOMLPSIYJPWLX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(C1=O)C=C(C=C2)O |
Computed by PubChem (NCBI)