cas: 872998-61-3 — see every product listed under this CAS number, including other names
2,4-Dibromoquinazoline 95% (CAS 872998-61-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196026-250mg |
| cas | 872998-61-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196026 |
2,4-dibromoquinazoline (CAS 872998-61-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,4-dibromoquinazoline. InChIKey: CDBAGRHVFMGOON-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,4-dibromoquinazoline |
| InChIKey | CDBAGRHVFMGOON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Br)Br |
Computed by PubChem (NCBI)