cas: 28252-82-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-1,5-naphthyridine, 98% (CAS 28252-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F780110-100MG |
| cas | 28252-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1091.30 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 1g | 5292.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dichloro-1,5-naphthyridine (CAS 28252-82-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloro-1,5-naphthyridine. InChIKey: BXXUGCOGJVNBKY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloro-1,5-naphthyridine |
| InChIKey | BXXUGCOGJVNBKY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=N2)Cl)Cl)N=C1 |
Computed by PubChem (NCBI)