CAS 67092-20-0 appears in our catalog under these names: 2,8-Dichloroquinazoline, 95%, 2,8-Dichloroquinazoline, 98%, 98%, 2,8-Dichloroquinazoline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg, 500mg.
2,8-dichloroquinazoline (CAS 67092-20-0) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloroquinazoline. InChIKey: JLCHUDPERPLJPI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloroquinazoline |
| InChIKey | JLCHUDPERPLJPI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)