CAS 28252-82-6 appears in our catalog under these names: 2,4-Dichloro-1,5-naphthyridine, 95%, 2,4-dichloro-1,5-naphthyridine, 2,4-Dichloro-1,5-naphthyridine 95%, 2,4-Dichloro-1,5-naphthyridine, 95%, 95%, 2,4-Dichloro-1,5-naphthyridine, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 5g.
2,4-dichloro-1,5-naphthyridine (CAS 28252-82-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloro-1,5-naphthyridine. InChIKey: BXXUGCOGJVNBKY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloro-1,5-naphthyridine |
| InChIKey | BXXUGCOGJVNBKY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=N2)Cl)Cl)N=C1 |
Computed by PubChem (NCBI)