CAS 2148-55-2 appears in our catalog under these names: 4,5-Dichloroquinazoline, 97%, 4,5–Dichloroquinazoline, 4,5-Dichloroquinazoline, 4,5-Dichloroquinazoline, >95%, >95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2.5g.
4,5-dichloroquinazoline (CAS 2148-55-2) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,5-dichloroquinazoline. InChIKey: PCCZEWAQRDIOKD-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,5-dichloroquinazoline |
| InChIKey | PCCZEWAQRDIOKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)