CAS 67092-18-6 appears in our catalog under these names: 2,6-Dichloroquinazoline, 95%, 2,6-Dichloroquinazoline, 97%, 2,6-dichloroquinazoline, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg.
2,6-dichloroquinazoline (CAS 67092-18-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,6-dichloroquinazoline. InChIKey: XRATUNPMHQSOFL-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,6-dichloroquinazoline |
| InChIKey | XRATUNPMHQSOFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)