CAS 120258-69-7 appears in our catalog under these names: 2,8-Dichloroquinoxaline, 96%, 2,8-Dichloroquinoxaline, 98%, 2,8–Dichloroquinoxaline, 2,8-Dichloroquinoxaline, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2,8-dichloroquinoxaline (CAS 120258-69-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloroquinoxaline. InChIKey: OSJZMZFNSNCFCO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloroquinoxaline |
| InChIKey | OSJZMZFNSNCFCO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)