CAS 1260898-43-8 appears in our catalog under these names: 2,6-Dichloro-1,8-naphthyridine, 95%, 2,6-Dichloro-1,8-naphthyridine, 98%, 98%, 2,6-Dichloro-1,8-naphthyridine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.
2,6-dichloro-1,8-naphthyridine (CAS 1260898-43-8) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,6-dichloro-1,8-naphthyridine. InChIKey: KHTSXPVKNKHVDM-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,6-dichloro-1,8-naphthyridine |
| InChIKey | KHTSXPVKNKHVDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)